| user: | sadfaceunread |
| created: | September 14, 2010 |
| karma: | 771 |
| about: | Hard Science / Data Science. I apply machine learning to problems in chemical and pharmaceutical industries. |
| 1. | What Twitter Can Be(lowercasecapital.com) |
| 2. | Twitter Restructures Product Team(recode.net) |
| 3. | $500k of Azure credit for YC startups(blog.ycombinator.com) |
| 4. | The Forever Professors(chronicle.com) |
| 5. | |
| 6. | Kitchen counter bio hacking(joi.ito.com) |
| 7. |